EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H28O5 |
| Net Charge | 0 |
| Average Mass | 432.516 |
| Monoisotopic Mass | 432.19367 |
| SMILES | CC(C)=CCc1cc(/C=C2\OC(=O)C(c3ccc(O)c(CC=C(C)C)c3)=C2O)ccc1O |
| InChI | InChI=1S/C27H28O5/c1-16(2)5-8-19-13-18(7-11-22(19)28)14-24-26(30)25(27(31)32-24)21-10-12-23(29)20(15-21)9-6-17(3)4/h5-7,10-15,28-30H,8-9H2,1-4H3/b24-14- |
| InChIKey | LFDYHAWYVIBCDT-OYKKKHCWSA-N |
| Roles Classification |
|---|
| Biological Role: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aspulvinone H (CHEBI:17099) is a aspulvinone (CHEBI:22669) |
| aspulvinone H (CHEBI:17099) is conjugate acid of aspulvinone H(1−) (CHEBI:58013) |
| Incoming Relation(s) |
| aspulvinone H(1−) (CHEBI:58013) is conjugate base of aspulvinone H (CHEBI:17099) |
| IUPAC Name |
|---|
| 4-hydroxy-5-[4-hydroxy-3-(3-methylbut-2-en-1-yl)benzylidene]-3-[4-hydroxy-3-(3-methylbut-2-en-1-yl)phenyl]furan-2(5H)-one |
| Synonym | Source |
|---|---|
| Aspulvinone H | KEGG COMPOUND |