EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | COc1ccc(C=O)cc1OC |
| InChI | InChI=1S/C9H10O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-6H,1-2H3 |
| InChIKey | WJUFSDZVCOTFON-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| veratraldehyde (CHEBI:17098) has role antifungal agent (CHEBI:35718) |
| veratraldehyde (CHEBI:17098) is a benzaldehydes (CHEBI:22698) |
| veratraldehyde (CHEBI:17098) is a dimethoxybenzene (CHEBI:51681) |
| IUPAC Name |
|---|
| 3,4-dimethoxybenzaldehyde |
| Synonyms | Source |
|---|---|
| 3,4-dimethoxybenzaldehyde | ChEBI |
| 3,4-Dimethoxybenzaldehyde | KEGG COMPOUND |
| Veratraldehyde | KEGG COMPOUND |
| Veratric aldehyde | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 3,4-dimethoxybenzaldehyde | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02201 | KEGG COMPOUND |
| HMDB0032138 | HMDB |
| Veratraldehyde | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:473899 | Reaxys |
| CAS:120-14-9 | KEGG COMPOUND |
| Citations |
|---|