EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2O4 |
| Net Charge | 0 |
| Average Mass | 368.433 |
| Monoisotopic Mass | 368.17361 |
| SMILES | [H][C@]1(C=C)[C@H](O)OC=C(C(=O)OC)[C@@]1([H])C[C@]1([H])NCCc2c1nc1ccccc21 |
| InChI | InChI=1S/C21H24N2O4/c1-3-12-15(16(20(24)26-2)11-27-21(12)25)10-18-19-14(8-9-22-18)13-6-4-5-7-17(13)23-19/h3-7,11-12,15,18,21-23,25H,1,8-10H2,2H3/t12-,15+,18+,21-/m1/s1 |
| InChIKey | HXLWDALZXJIPSY-LPIRWUFSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| strictosidine aglycone (CHEBI:17096) is a alkaloid ester (CHEBI:38481) |
| strictosidine aglycone (CHEBI:17096) is a indole alkaloid (CHEBI:38958) |
| strictosidine aglycone (CHEBI:17096) is a methyl ester (CHEBI:25248) |
| strictosidine aglycone (CHEBI:17096) is conjugate base of strictosidine aglycone(1+) (CHEBI:58012) |
| Incoming Relation(s) |
| strictosidine aglycone(1+) (CHEBI:58012) is conjugate acid of strictosidine aglycone (CHEBI:17096) |
| IUPAC Name |
|---|
| methyl (2R,3R,4S)-3-ethenyl-2-hydroxy-4-{[(1S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]methyl}-3,4-dihydro-2H-pyran-5-carboxylate |
| Synonym | Source |
|---|---|
| Strictosidine aglycone | KEGG COMPOUND |
| Citations |
|---|