EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H68O7P2 |
| Net Charge | 0 |
| Average Mass | 722.925 |
| Monoisotopic Mass | 722.44403 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/[C@@H]1[C@@H](COP(=O)(O)OP(=O)(O)O)[C@]1(C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C40H68O7P2/c1-31(2)17-11-19-33(5)21-13-23-35(7)25-15-26-37(9)29-38-39(30-46-49(44,45)47-48(41,42)43)40(38,10)28-16-27-36(8)24-14-22-34(6)20-12-18-32(3)4/h17-18,21-22,25,27,29,38-39H,11-16,19-20,23-24,26,28,30H2,1-10H3,(H,44,45)(H2,41,42,43)/b33-21+,34-22+,35-25+,36-27+,37-29+/t38-,39-,40-/m1/s1 |
| InChIKey | RVCNKTPCHZNAAO-UZDKSQMHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2R,3R)-prephytoene diphosphate (CHEBI:17090) is a prephytoene diphosphate (CHEBI:14885) |
| (1R,2R,3R)-prephytoene diphosphate (CHEBI:17090) is conjugate acid of (1R,2R,3R)-prephytoene diphosphate(3−) (CHEBI:58011) |
| (1R,2R,3R)-prephytoene diphosphate (CHEBI:17090) is enantiomer of (1S,2S,3S)-prephytoene diphosphate (CHEBI:50279) |
| Incoming Relation(s) |
| (1R,2R,3R)-prephytoene diphosphate(3−) (CHEBI:58011) is conjugate base of (1R,2R,3R)-prephytoene diphosphate (CHEBI:17090) |
| (1S,2S,3S)-prephytoene diphosphate (CHEBI:50279) is enantiomer of (1R,2R,3R)-prephytoene diphosphate (CHEBI:17090) |
| IUPAC Name |
|---|
| {(1R,2R,3R)-2-methyl-3-[(1E,5E,9E)-2,6,10,14-tetramethylpentadeca-1,5,9,13-tetraen-1-yl]-2-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]cyclopropyl}methyl trihydrogen diphosphate |
| Synonym | Source |
|---|---|
| Prephytoene diphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03427 | KEGG COMPOUND |
| LMPR01070253 | LIPID MAPS |