EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21NO4 |
| Net Charge | 0 |
| Average Mass | 315.369 |
| Monoisotopic Mass | 315.14706 |
| SMILES | COc1cc(CC2NCCc3cc(OC)c(O)cc32)ccc1O |
| InChI | InChI=1S/C18H21NO4/c1-22-17-8-11(3-4-15(17)20)7-14-13-10-16(21)18(23-2)9-12(13)5-6-19-14/h3-4,8-10,14,19-21H,5-7H2,1-2H3 |
| InChIKey | WQTCGADWPORGNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nororientaline (CHEBI:17048) is a isoquinoline alkaloid (CHEBI:24921) |
| nororientaline (CHEBI:17048) is a isoquinolines (CHEBI:24922) |
| nororientaline (CHEBI:17048) is a isoquinolinol (CHEBI:24923) |
| nororientaline (CHEBI:17048) is conjugate base of nororientalinium(1+) (CHEBI:57996) |
| Incoming Relation(s) |
| (S)-nororientaline (CHEBI:28594) is a nororientaline (CHEBI:17048) |
| nororientalinium(1+) (CHEBI:57996) is conjugate acid of nororientaline (CHEBI:17048) |
| IUPAC Name |
|---|
| 1-(4-hydroxy-3-methoxybenzyl)-6-methoxy-1,2,3,4-tetrahydroisoquinolin-7-ol |
| Synonym | Source |
|---|---|
| Nororientaline | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05317 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:314888 | Beilstein |