EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C55H92O7P2 |
| Net Charge | 0 |
| Average Mass | 927.282 |
| Monoisotopic Mass | 926.63183 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C55H92O7P2/c1-45(2)23-13-24-46(3)25-14-26-47(4)27-15-28-48(5)29-16-30-49(6)31-17-32-50(7)33-18-34-51(8)35-19-36-52(9)37-20-38-53(10)39-21-40-54(11)41-22-42-55(12)43-44-61-64(59,60)62-63(56,57)58/h23,25,27,29,31,33,35,37,39,41,43H,13-22,24,26,28,30,32,34,36,38,40,42,44H2,1-12H3,(H,59,60)(H2,56,57,58)/b46-25+,47-27+,48-29+,49-31+,50-33+,51-35+,52-37+,53-39+,54-41+,55-43+ |
| InChIKey | NTXGVHCCXVHYCL-RDQGWRCRSA-N |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| all-trans-undecaprenyl diphosphate (CHEBI:17047) is a all-trans-polyprenyl diphosphate (CHEBI:55337) |
| all-trans-undecaprenyl diphosphate (CHEBI:17047) is a undecaprenyl diphosphate (CHEBI:53042) |
| all-trans-undecaprenyl diphosphate (CHEBI:17047) is a undecaprenyl phosphate (CHEBI:27193) |
| all-trans-undecaprenyl diphosphate (CHEBI:17047) is conjugate acid of all-trans-undecaprenyl diphosphate(3−) (CHEBI:57995) |
| Incoming Relation(s) |
| all-trans-undecaprenyl diphosphate(3−) (CHEBI:57995) is conjugate base of all-trans-undecaprenyl diphosphate (CHEBI:17047) |
| IUPAC Name |
|---|
| (2E,6E,10E,14E,18E,22E,26E,30E,34E,38E)-3,7,11,15,19,23,27,31,35,39,43-undecamethyltetratetraconta-2,6,10,14,18,22,26,30,34,38,42-undecaen-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| C55-isoprenyl pyrophosphate | ChEBI |
| Diphosphoric acid, mono(3,7,11,15,19,23,27,31,35,39,43-undecamethyl-2,6,10,14,18,22,26,30,34,38,42-tetratetracontaundecaenyl) ester | ChemIDplus |
| undecaprenyl diphosphate | KEGG COMPOUND |
| undecaprenyl pyrophosphate | ChemIDplus |
| undecaprenyl trihydrogen diphosphate | LIPID MAPS |
| UndPP | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| FDB022641 | FooDB |
| HMDB0001469 | HMDB |
| LMPR03030004 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:31867-59-1 | ChemIDplus |
| Citations |
|---|