EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6O4 |
| Net Charge | 0 |
| Average Mass | 214.176 |
| Monoisotopic Mass | 214.02661 |
| SMILES | O=c1cc2oc3ccccc3oc-2cc1=O |
| InChI | InChI=1S/C12H6O4/c13-7-5-11-12(6-8(7)14)16-10-4-2-1-3-9(10)15-11/h1-6H |
| InChIKey | OEZWQQMRIGCJRU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzo[1,4]dioxine-2,3-dione (CHEBI:17036) is a dibenzodioxine (CHEBI:23825) |
| dibenzo[1,4]dioxine-2,3-dione (CHEBI:17036) is a orthoquinones (CHEBI:25622) |
| IUPAC Name |
|---|
| oxanthrene-2,3-dione |
| Synonyms | Source |
|---|---|
| Dibenzo[1,4]dioxin-2,3-dione | KEGG COMPOUND |
| dibenzo[b,e][1,4]dioxine-2,3-dione | IUPAC |
| Diphenylene dioxide 2,3-quinone | ChemIDplus |
| Diphenylenedioxide-2,3-quinone | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| dibenzo[1,4]dioxin-2,3-dione | UniProt |