EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N2O8P |
| Net Charge | 0 |
| Average Mass | 322.210 |
| Monoisotopic Mass | 322.05660 |
| SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](COP(=O)(O)O)O2)c(=O)nc1=O |
| InChI | InChI=1S/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(13)7(20-8)4-19-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/t6-,7+,8+/m0/s1 |
| InChIKey | GYOZYWVXFNDGLU-XLPZGREQSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | fundamental metabolite Any metabolite produced by all living cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTMP (CHEBI:17013) has role fundamental metabolite (CHEBI:78675) |
| dTMP (CHEBI:17013) is a thymidine 5'-monophosphate (CHEBI:15245) |
| dTMP (CHEBI:17013) is conjugate acid of dTMP− (CHEBI:46960) |
| dTMP (CHEBI:17013) is enantiomer of 1-(2-deoxy-5-O-phosphono-β-L-ribofuranosyl)thymine (CHEBI:42112) |
| Incoming Relation(s) |
| p-nitrophenyl thymidine 5'-monophosphate (CHEBI:74144) has functional parent dTMP (CHEBI:17013) |
| 5,6-dihydrothymidine 5'-monophosphate (CHEBI:132172) has functional parent dTMP (CHEBI:17013) |
| dTMP− (CHEBI:46960) is conjugate base of dTMP (CHEBI:17013) |
| 1-(2-deoxy-5-O-phosphono-β-L-ribofuranosyl)thymine (CHEBI:42112) is enantiomer of dTMP (CHEBI:17013) |
| dTMP 3'-end residue (CHEBI:53118) is substituent group from dTMP (CHEBI:17013) |
| dTMP 5'-end residue (CHEBI:53102) is substituent group from dTMP (CHEBI:17013) |
| thymidine 5'-monophosphate residue (CHEBI:50300) is substituent group from dTMP (CHEBI:17013) |
| IUPAC Names |
|---|
| 2'-deoxy-5-methyluridine 5'-(dihydrogen phosphate) |
| 5'-thymidylic acid |
| Synonyms | Source |
|---|---|
| 5-methyl-dUMP | ChemIDplus |
| 5'-Thymidylic acid | KEGG COMPOUND |
| 5'-TMP | ChemIDplus |
| deoxyribosylthymine monophosphate | ChemIDplus |
| (dT)1 | ChEBI |
| ribothymidine 5'-monophosphate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00019637 | KNApSAcK |
| C00364 | KEGG COMPOUND |
| DB01643 | DrugBank |
| HMDB0001227 | HMDB |
| TdF10 | PDBeChem |
| Thymidine_monophosphate | Wikipedia |
| TMPdF10 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:47541 | Beilstein |
| Reaxys:47541 | Reaxys |
| CAS:365-07-1 | KEGG COMPOUND |
| CAS:365-07-1 | ChemIDplus |
| Citations |
|---|