EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O2 |
| Net Charge | 0 |
| Average Mass | 330.512 |
| Monoisotopic Mass | 330.25588 |
| SMILES | CC/C=C/CC/C=C/C/C=C/CC/C=C/CC/C=C/CCC(=O)O |
| InChI | InChI=1S/C22H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(23)24/h3-4,7-8,10-11,14-15,18-19H,2,5-6,9,12-13,16-17,20-21H2,1H3,(H,23,24)/b4-3+,8-7+,11-10+,15-14+,19-18+ |
| InChIKey | PIFPCDRPHCQLSJ-WYIJOVFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | ||
| NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| HeLa cell;NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| HeLa cell (BTO:0000567) | MetaboLights (MTBLS78) | ||
| Mus musculus (ncbitaxon:10090) | Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,8,12,15,19-Docosapentaenoic acid (CHEBI:170127) is a very long-chain fatty acid (CHEBI:27283) |
| IUPAC Name |
|---|
| (4E,8E,12E,15E,19E)-docosa-4,8,12,15,19-pentaenoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4445976 | ChemSpider |
| LMFA01030183 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2548-85-8 | ChemIDplus |