EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19N5O6S |
| Net Charge | 0 |
| Average Mass | 385.402 |
| Monoisotopic Mass | 385.10560 |
| SMILES | N[C@@H](CCSC[C@H]1O[C@@H](n2cnc3c(O)ncnc32)[C@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C14H19N5O6S/c15-6(14(23)24)1-2-26-3-7-9(20)10(21)13(25-7)19-5-18-8-11(19)16-4-17-12(8)22/h4-7,9-10,13,20-21H,1-3,15H2,(H,23,24)(H,16,17,22)/t6-,7+,9+,10+,13+/m0/s1 |
| InChIKey | VNPWVMVYUSNFAW-WFMPWKQPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-inosyl-L-homocysteine (CHEBI:17010) is a homocysteines (CHEBI:24610) |
| S-inosyl-L-homocysteine (CHEBI:17010) is tautomer of S-inosyl-L-homocysteine zwitterion (CHEBI:57985) |
| Incoming Relation(s) |
| S-inosyl-L-homocysteine zwitterion (CHEBI:57985) is tautomer of S-inosyl-L-homocysteine (CHEBI:17010) |
| IUPAC Name |
|---|
| S-(5'-deoxyinosin-5'-yl)-L-homocysteine |
| Synonym | Source |
|---|---|
| S-Inosyl-L-homocysteine | KEGG COMPOUND |