EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CC(C)CCCCCC/C=C/CCCCC(=O)O |
| InChI | InChI=1S/C16H30O2/c1-15(2)13-11-9-7-5-3-4-6-8-10-12-14-16(17)18/h4,6,15H,3,5,7-14H2,1-2H3,(H,17,18)/b6-4+ |
| InChIKey | PLEXOMFVUZNSTQ-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| HeLa cell (BTO:0000567) | MetaboLights (MTBLS78) | ||
| NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | ||
| HeLa cell;NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| Mus musculus (ncbitaxon:10090) | Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-14-Methyl-6-pentadecenoic acid (CHEBI:170089) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-14-methylpentadec-6-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30777567 | ChemSpider |
| HMDB0041422 | HMDB |