EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11ClN2O2 |
| Net Charge | 0 |
| Average Mass | 238.674 |
| Monoisotopic Mass | 238.05091 |
| SMILES | NC(Cc1cnc2cccc(Cl)c12)C(=O)O |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-2-1-3-9-10(7)6(5-14-9)4-8(13)11(15)16/h1-3,5,8,14H,4,13H2,(H,15,16) |
| InChIKey | NRTHKYABOMUPSC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | ||
| HeLa cell;NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| HeLa cell (BTO:0000567) | MetaboLights (MTBLS78) | ||
| NIH-3T3 cell (BTO:0000944) | MetaboLights (MTBLS78) | ||
| Mus musculus (ncbitaxon:10090) | Hepa-RG cell (BTO:0005736) | MetaboLights (MTBLS78) | Strain: C57BL/6J [EFO:0000606] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-4-Chlorotryptophan (CHEBI:170088) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2-amino-3-(4-chloro-1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10498613 | ChemSpider |
| HMDB0030400 | HMDB |