EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO2.HCl |
| Net Charge | 0 |
| Average Mass | 281.783 |
| Monoisotopic Mass | 281.11826 |
| SMILES | Cl.O=C(O)CCCN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H19NO2.ClH/c17-15(18)7-4-10-16-11-8-14(9-12-16)13-5-2-1-3-6-13;/h1-3,5-6,8H,4,7,9-12H2,(H,17,18);1H |
| InChIKey | OUUJCRMFXWWRGV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Pseudomonas aeruginosa UCBPP-PA14 [NCBI:txid208963] | |
| Pseudomonas aeruginosa/Staphylococcus aureus (ncbitaxon:1280) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | |
| Staphylococcus aureus (ncbitaxon:1280) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Staphylococcus aureus subsp. aureus USA300 [NCBI:txid367830] | |
| unidentified (ncbitaxon:32644) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-[4-phenyl-3,6-dihydro-1(2H)-pyridinyl]butanoic acid hydrochloride (CHEBI:170057) is a amino fatty acid (CHEBI:59650) |
| IUPAC Name |
|---|
| 4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butanoic acid;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 2101335 | ChemSpider |