EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H23NO2 |
| Net Charge | 0 |
| Average Mass | 285.387 |
| Monoisotopic Mass | 285.17288 |
| SMILES | Cc1ccc(OCC(O)CNCc2ccccc2)cc1C |
| InChI | InChI=1S/C18H23NO2/c1-14-8-9-18(10-15(14)2)21-13-17(20)12-19-11-16-6-4-3-5-7-16/h3-10,17,19-20H,11-13H2,1-2H3 |
| InChIKey | HEFPHRMJPGVGHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| unidentified (ncbitaxon:32644) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | |
| Pseudomonas aeruginosa (ncbitaxon:287) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Pseudomonas aeruginosa UCBPP-PA14 [NCBI:txid208963] | |
| Staphylococcus aureus (ncbitaxon:1280) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Staphylococcus aureus subsp. aureus USA300 [NCBI:txid367830] | |
| Pseudomonas aeruginosa/Staphylococcus aureus (ncbitaxon:1280) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(Benzylamino)-3-(3,4-dimethylphenoxy)propan-2-ol (CHEBI:170051) is a aromatic amine (CHEBI:33860) |
| IUPAC Name |
|---|
| 1-(benzylamino)-3-(3,4-dimethylphenoxy)propan-2-ol |
| Manual Xrefs | Databases |
|---|---|
| 2074882 | ChemSpider |