EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21NO2 |
| Net Charge | 0 |
| Average Mass | 259.349 |
| Monoisotopic Mass | 259.15723 |
| SMILES | [H][C@@]12Cc3ccc(O)cc3[C@]3(CCCC[C@]31O)CCN2 |
| InChI | InChI=1S/C16H21NO2/c18-12-4-3-11-9-14-16(19)6-2-1-5-15(16,7-8-17-14)13(11)10-12/h3-4,10,14,17-19H,1-2,5-9H2/t14-,15+,16-/m1/s1 |
| InChIKey | GJOVVPXDEXUSTC-OWCLPIDISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Pseudomonas aeruginosa UCBPP-PA14 [NCBI:txid208963] | |
| Staphylococcus aureus (ncbitaxon:1280) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Staphylococcus aureus subsp. aureus USA300 [NCBI:txid367830] | |
| Pseudomonas aeruginosa/Staphylococcus aureus (ncbitaxon:1280) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | |
| unidentified (ncbitaxon:32644) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Norbutorphanol (CHEBI:170038) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1S,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-4,10-diol |
| Manual Xrefs | Databases |
|---|---|
| 20130087 | ChemSpider |
| HMDB0041954 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3792-68-5 | ChemIDplus |