EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O5 |
| Net Charge | 0 |
| Average Mass | 370.405 |
| Monoisotopic Mass | 370.15287 |
| SMILES | O=C(O)CC(CC(=O)N1CCN(C(=O)c2ccco2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O5/c23-18(13-16(14-19(24)25)15-5-2-1-3-6-15)21-8-10-22(11-9-21)20(26)17-7-4-12-27-17/h1-7,12,16H,8-11,13-14H2,(H,24,25) |
| InChIKey | ZRWCVASLBYKEPY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas aeruginosa (ncbitaxon:287) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Pseudomonas aeruginosa UCBPP-PA14 [NCBI:txid208963] | |
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| Pseudomonas aeruginosa/Staphylococcus aureus (ncbitaxon:1280) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | |
| Staphylococcus aureus (ncbitaxon:1280) | |||
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | Strain: Staphylococcus aureus subsp. aureus USA300 [NCBI:txid367830] | |
| Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) | ||
| unidentified (ncbitaxon:32644) | Culture media, conditioned (OMIT:0017487) | MetaboLights (MTBLS2105) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[4-(2-furylcarbonyl)piperazino]-5-oxo-3-phenylpentanoic acid (CHEBI:170035) is a benzenes (CHEBI:22712) |
| 5-[4-(2-furylcarbonyl)piperazino]-5-oxo-3-phenylpentanoic acid (CHEBI:170035) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| 5-[4-(uran-2-carbonyl)piperazin-1-yl]-5-oxo-3-phenylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 2090681 | ChemSpider |