EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O2 |
| Net Charge | 0 |
| Average Mass | 370.577 |
| Monoisotopic Mass | 370.28718 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C(=O)O)=C/C[C@@]1(C)CC[C@]1([H])[C@@H](C(=C)C)CC[C@@]21C |
| InChI | InChI=1S/C25H38O2/c1-17(2)20-12-16-25(5)21(20)13-15-24(4)14-11-19(23(26)27)8-6-7-18(3)9-10-22(24)25/h7,11,20-22H,1,6,8-10,12-16H2,2-5H3,(H,26,27)/b18-7+,19-11-/t20-,21-,22-,24+,25-/m1/s1 |
| InChIKey | FSKFLBQJBSQQKA-DMZCBJAKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus stellatus (ncbitaxon:1549217) | - | PubMed (15612624) | Species also known as Emericella variecolor. |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| stellatic acid (CHEBI:169999) has role Aspergillus metabolite (CHEBI:76956) |
| stellatic acid (CHEBI:169999) is a carbotricyclic compound (CHEBI:38032) |
| stellatic acid (CHEBI:169999) is a monocarboxylic acid (CHEBI:25384) |
| stellatic acid (CHEBI:169999) is a polycyclic olefin (CHEBI:35714) |
| stellatic acid (CHEBI:169999) is a sesterterpenoid (CHEBI:26660) |
| stellatic acid (CHEBI:169999) is conjugate acid of stellatate (CHEBI:167454) |
| Incoming Relation(s) |
| stellatate (CHEBI:167454) is conjugate base of stellatic acid (CHEBI:169999) |
| IUPAC Name |
|---|
| (3S,3aR,5aR,7Z,11E,14aR,14bR)-5a,12,14b-trimethyl-3-(prop-1-en-2-yl)-1,2,3,3a,4,5,5a,6,9,10,13,14,14a,14b-tetradecahydrocycloundeca[e]indene-8-carboxylic acid |
| Citations |
|---|