EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:169993 - Picolinic acid N-oxide
| Formula | C6H5NO3 |
| Net Charge | 0 |
| Average Mass | 139.110 |
| Monoisotopic Mass | 139.02694 |
| SMILES | O=C(O)c1cccc[n+]1[O-] |
| InChI | InChI=1S/C6H5NO3/c8-6(9)5-3-1-2-4-7(5)10/h1-4H,(H,8,9) |
| InChIKey | FHYMLBVGNFVFBT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus Musculus (ncbitaxon:10090) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] | |
| liver (BTO:0000759) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Picolinic acid N-oxide (CHEBI:169993) is a aromatic carboxylic acid (CHEBI:33859) |
| Picolinic acid N-oxide (CHEBI:169993) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| 1-oxidopyridin-1-ium-2-carboxylic acid |