EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10O3 |
| Net Charge | 0 |
| Average Mass | 166.176 |
| Monoisotopic Mass | 166.06299 |
| SMILES | CC(Oc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H10O3/c1-7(9(10)11)12-8-5-3-2-4-6-8/h2-7H,1H3,(H,10,11) |
| InChIKey | SXERGJJQSKIUIC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus Musculus (ncbitaxon:10090) | |||
| blood plasma (BTO:0000131) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] | |
| liver (BTO:0000759) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Phenoxypropionic acid (CHEBI:169988) is a aromatic ether (CHEBI:35618) |
| 2-Phenoxypropionic acid (CHEBI:169988) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 2-phenoxypropanoic acid |