EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | COc1cccc(O)c1C(=O)O |
| InChI | InChI=1S/C8H8O4/c1-12-6-4-2-3-5(9)7(6)8(10)11/h2-4,9H,1H3,(H,10,11) |
| InChIKey | AAUQLHHARJUJEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus Musculus (ncbitaxon:10090) | |||
| liver (BTO:0000759) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] | |
| blood plasma (BTO:0000131) | MetaboLights (MTBLS1903) | Strain: C57BL/6N Mouse [THESAURUS.OWL#C37385] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-Methoxysalicylic acid (CHEBI:169986) is a methoxybenzoic acid (CHEBI:25238) |
| IUPAC Name |
|---|
| 2-hydroxy-6-methoxybenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 514231 | ChemSpider |