EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O8P |
| Net Charge | -2 |
| Average Mass | 361.207 |
| Monoisotopic Mass | 361.04345 |
| SMILES | Nc1nc(O)nc2c1ncn2[C@@H]1O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C10H14N5O8P/c11-7-4-8(14-10(18)13-7)15(2-12-4)9-6(17)5(16)3(23-9)1-22-24(19,20)21/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18)/p-2/t3-,5-,6-,9-/m1/s1 |
| InChIKey | CGCGQFDYTLYDPF-UUOKFMHZSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-AMP(2−) (CHEBI:169971) is a nucleoside 5'-monophosphate(2−) (CHEBI:58043) |
| 2-hydroxy-AMP(2−) (CHEBI:169971) is conjugate base of 2-hydroxy-AMP (CHEBI:65129) |
| Incoming Relation(s) |
| 2-hydroxy-AMP (CHEBI:65129) is conjugate acid of 2-hydroxy-AMP(2−) (CHEBI:169971) |
| IUPAC Name |
|---|
| 2-hydroxy-5'-O-phosphonatoadenosine |
| Synonyms | Source |
|---|---|
| 2-hydroxyadenosine 5'-phosphate dianion | ChEBI |
| 2-hydroxy-AMP dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-hydroxy-AMP | UniProt |