EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H32N8O7S |
| Net Charge | 0 |
| Average Mass | 696.746 |
| Monoisotopic Mass | 696.21147 |
| SMILES | CC[C@@H](C)[C@H]1NC(=O)c2nc(oc2-c2ccccc2)-c2csc(n2)-c2coc(n2)-c2coc(n2)-c2coc(n2)CNC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C34H32N8O7S/c1-5-17(4)25-29(44)40-24(16(2)3)28(43)35-11-23-36-19(12-46-23)31-37-20(13-47-31)32-38-21(14-48-32)34-39-22(15-50-34)33-42-26(30(45)41-25)27(49-33)18-9-7-6-8-10-18/h6-10,12-17,24-25H,5,11H2,1-4H3,(H,35,43)(H,40,44)(H,41,45)/t17-,24+,25-/m1/s1 |
| InChIKey | TXKVZUHICTYULO-HCOMASKESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nobilis (ncbitaxon:66901) | mycelium (BTO:0001436) | PubMed (15813178) | Strain: JCM 4274 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| YM-216391 (CHEBI:169951) has role antineoplastic agent (CHEBI:35610) |
| YM-216391 (CHEBI:169951) has role bacterial metabolite (CHEBI:76969) |
| YM-216391 (CHEBI:169951) is a 1,3-oxazoles (CHEBI:46812) |
| YM-216391 (CHEBI:169951) is a 1,3-thiazoles (CHEBI:38418) |
| YM-216391 (CHEBI:169951) is a azamacrocycle (CHEBI:52898) |
| YM-216391 (CHEBI:169951) is a benzenes (CHEBI:22712) |
| YM-216391 (CHEBI:169951) is a heterodetic cyclic peptide (CHEBI:24533) |
| IUPAC Name |
|---|
| (20R,23S)-20-[(2R)-butan-2-yl]-16-phenyl-23-(propan-2-yl)-3,7,15,28-tetraoxa-11-thia-19,22,25,30,31,32,33,34-octaazahexacyclo[25.2.1.12,5.16,9.110,13.114,17]tetratriaconta-1(29),2(34),4,6(33),8,10(32),12,14(31),16,27(30)-decaene-18,21,24-trione |
| Synonyms | Source |
|---|---|
| YM 216391 | ChEBI |
| YM216391 | ChEBI |
| Citations |
|---|