EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O9 |
| Net Charge | 0 |
| Average Mass | 420.414 |
| Monoisotopic Mass | 420.14203 |
| SMILES | COc1ccc(/C=C\c2cc(O)cc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O |
| InChI | InChI=1S/C21H24O9/c1-28-16-5-4-11(8-15(16)24)2-3-12-6-13(23)9-14(7-12)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2-/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GKAJCVFOJGXVIA-JGOUSXGWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rheum undulatum (ncbitaxon:137227) | rhizome (BTO:0001181) | PubMed (29402747) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. phytoestrogen Any compound produced by a plant that happens to have estrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-rhaponticin (CHEBI:169947) has role phytoestrogen (CHEBI:76989) |
| cis-rhaponticin (CHEBI:169947) has role plant metabolite (CHEBI:76924) |
| cis-rhaponticin (CHEBI:169947) is a rhaponticin (CHEBI:92176) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(Z)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| (Z)-rhaponticin | ChEBI |
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol | IUPAC |
| (2S,3R,4S,5S,6R)-2-{3-hydroxy-5-[(Z)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenoxy}-6-(hydroxymethyl)oxane-3,4,5-triol | IUPAC |
| Citations |
|---|