EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25O12 |
| Net Charge | -1 |
| Average Mass | 505.452 |
| Monoisotopic Mass | 505.13515 |
| SMILES | COc1ccc(/C=C/c2cc(O)cc(O[C@@H]3O[C@H](COC(=O)CC(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)c2)cc1O |
| InChI | InChI=1S/C24H26O12/c1-33-17-5-4-12(8-16(17)26)2-3-13-6-14(25)9-15(7-13)35-24-23(32)22(31)21(30)18(36-24)11-34-20(29)10-19(27)28/h2-9,18,21-26,30-32H,10-11H2,1H3,(H,27,28)/p-1/b3-2+/t18-,21-,22+,23-,24-/m1/s1 |
| InChIKey | FZBULCMNVYWMJO-YKQZOWBRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-O-malonyl-trans-rhaponticin(1−) (CHEBI:169946) is a dicarboxylic acid monoester(1−) (CHEBI:131605) |
| 6-O-malonyl-trans-rhaponticin(1−) (CHEBI:169946) is conjugate base of 6-O-malonyl-trans-rhaponticin (CHEBI:177370) |
| Incoming Relation(s) |
| 6-O-malonyl-trans-rhaponticin (CHEBI:177370) is conjugate acid of 6-O-malonyl-trans-rhaponticin(1−) (CHEBI:169946) |
| IUPAC Name |
|---|
| 3-hydroxy-5-[(E)-2-(3-hydroxy-4-methoxyphenyl)ethenyl]phenyl 6-O-(carboxylatoacetyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 6-O-malonyl-trans-rhaponticin anion | ChEBI |
| 6-O-malonyl-rhaponticin anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 6-O-malonyl-rhaponticin | UniProt |
| Citations |
|---|