EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O7 |
| Net Charge | 0 |
| Average Mass | 262.218 |
| Monoisotopic Mass | 262.08010 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c10-4(8(15)16)1-2-6(12)11-5(9(17)18)3-7(13)14/h4-5H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | JTJZAUVWVBUZAU-WHFBIAKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gamma-Glutamylaspartic acid (CHEBI:169907) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 141603 | ChemSpider |
| HMDB0030419 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:16804-55-0 | ChemIDplus |