EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:169873 - 3,3-dichloro-propionic acid
| Formula | C3H4Cl2O2 |
| Net Charge | 0 |
| Average Mass | 142.969 |
| Monoisotopic Mass | 141.95883 |
| SMILES | O=C(O)CC(Cl)Cl |
| InChI | InChI=1S/C3H4Cl2O2/c4-2(5)1-3(6)7/h2H,1H2,(H,6,7) |
| InChIKey | HFPLCFMATPQWMD-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3-dichloro-propionic acid (CHEBI:169873) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| 3,3-dichloropropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01090067 | LIPID MAPS |
| 13355488 | ChemSpider |