EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H22O11 |
| Net Charge | 0 |
| Average Mass | 498.440 |
| Monoisotopic Mass | 498.11621 |
| SMILES | [H][C@@]12C[C@@](O)(C[C@@H](OC(=O)/C=C/c3ccc(O)c(O)c3)[C@H]1OC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)O2 |
| InChI | InChI=1S/C25H22O11/c26-15-5-1-13(9-17(15)28)3-7-21(30)34-19-11-25(33)12-20(35-24(25)32)23(19)36-22(31)8-4-14-2-6-16(27)18(29)10-14/h1-10,19-20,23,26-29,33H,11-12H2/b7-3+,8-4+/t19-,20-,23-,25+/m1/s1 |
| InChIKey | ZLYIWYCHNAZAQI-PSEXTPKNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-Dicaffeoyl-1,5-quinolactone (CHEBI:169847) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| [(1R,3R,4R,5R)-4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1-hydroxy-7-oxo-6-oxabicyclo[3.2.1]octan-3-yl] (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029291 | HMDB |
| 30776762 | ChemSpider |