EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO5 |
| Net Charge | 0 |
| Average Mass | 337.416 |
| Monoisotopic Mass | 337.18892 |
| SMILES | C/C=C(\C)C(=O)OC1CC2C(O)C(OC(=O)/C(C)=C/C)C(C1)N2C |
| InChI | InChI=1S/C18H27NO5/c1-6-10(3)17(21)23-12-8-13-15(20)16(14(9-12)19(13)5)24-18(22)11(4)7-2/h6-7,12-16,20H,8-9H2,1-5H3/b10-6+,11-7+ |
| InChIKey | FRQMNJFBOJQRAQ-JMQWPVDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,6-Ditigloyloxytropan-7-ol (CHEBI:169768) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| [6-hydroxy-8-methyl-7-[(E)-2-methylbut-2-enoyl]oxy-8-azabicyclo[3.2.1]octan-3-yl] (E)-2-methylbut-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029325 | HMDB |
| 35032850 | ChemSpider |