EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C50H86O7 |
| Net Charge | 0 |
| Average Mass | 799.231 |
| Monoisotopic Mass | 798.63736 |
| SMILES | CCCCCc1cc(C)c(CCCCCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCCCCCc2oc(CCCCC)c(C)c2C)o1 |
| InChI | InChI=1S/C50H86O7/c1-6-8-26-32-44-38-41(3)46(55-44)33-28-22-18-14-10-12-16-20-24-30-36-49(52)54-40-45(39-51)56-50(53)37-31-25-21-17-13-11-15-19-23-29-35-48-43(5)42(4)47(57-48)34-27-9-7-2/h38,45,51H,6-37,39-40H2,1-5H3/t45-/m0/s1 |
| InChIKey | JRIGPNIBCLRVKO-GWHBCOKCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DG(13M5/13D5/0:0) (CHEBI:169750) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| [(2S)-2-[13-(3,4-dimethyl-5-pentyluran-2-yl)tridecanoyloxy]-3-hydroxypropyl] 13-(3-methyl-5-pentyluran-2-yl)tridecanoate |
| Manual Xrefs | Databases |
|---|---|
| 74878130 | ChemSpider |
| HMDB0116418 | HMDB |