EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24D8O3 |
| Net Charge | 0 |
| Average Mass | 328.522 |
| Monoisotopic Mass | 328.28536 |
| SMILES | [2H]C(/C=C(\[2H])[C@@]([2H])(O)CCCCC)=C(\[2H])C/C([2H])=C(/[2H])C/C([2H])=C(/[2H])CCCC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-13-16-19(21)17-14-11-9-7-5-4-6-8-10-12-15-18-20(22)23/h4-5,8-11,14,17,19,21H,2-3,6-7,12-13,15-16,18H2,1H3,(H,22,23)/b5-4-,10-8-,11-9-,17-14+/t19-/m0/s1/i4D,5D,8D,9D,10D,11D,17D,19D |
| InChIKey | JSFATNQSLKRBCI-JCAMWLGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 15S-HETE-d8 (CHEBI:169748) is a deuterated fatty acid (CHEBI:75427) |
| 15S-HETE-d8 (CHEBI:169748) is a hydroxy fatty acid (CHEBI:24654) |
| 15S-HETE-d8 (CHEBI:169748) is a polyunsaturated fatty acid (CHEBI:26208) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,13E,15S)-5,6,8,9,11,12,14,15-octadeuterio-15-hydroxyicosa-5,8,11,13-tetraenoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA03060080 | LIPID MAPS |
| 17220805 | ChemSpider |