EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10N2OS |
| Net Charge | 0 |
| Average Mass | 206.270 |
| Monoisotopic Mass | 206.05138 |
| SMILES | Cc1nccnc1SCc1ccco1 |
| InChI | InChI=1S/C10H10N2OS/c1-8-10(12-5-4-11-8)14-7-9-3-2-6-13-9/h2-6H,7H2,1H3 |
| InChIKey | PFRSWMCUERVSAT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-3 or 5 or 6-(furfurylthio)pyrazine (mixture of isomers) (CHEBI:169721) is a aryl sulfide (CHEBI:35683) |
| IUPAC Name |
|---|
| 2-(uran-2-ylmethylsulanyl)-3-methylpyrazine |
| Manual Xrefs | Databases |
|---|---|
| 91252 | ChemSpider |
| HMDB0032414 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:59035-98-2 | ChemIDplus |