EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O12S2 |
| Net Charge | 0 |
| Average Mass | 491.417 |
| Monoisotopic Mass | 491.03766 |
| SMILES | NC1=NC2C(COC(=O)NS(=O)(=O)O)[N+]([O-])=C(N)N3CC(OS(=O)(=O)O)C(O)(O)C23N1 |
| InChI | InChI=1S/C10H17N7O12S2/c11-6-13-5-3(2-28-8(18)15-30(22,23)24)17(21)7(12)16-1-4(29-31(25,26)27)10(19,20)9(5,16)14-6/h3-5,19-20H,1-2,12H2,(H,15,18)(H3,11,13,14)(H,22,23,24)(H,25,26,27) |
| InChIKey | VZVIFCSIGSSLRG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Protogonyautoxin 3 (CHEBI:169715) has role marine metabolite (CHEBI:76507) |
| Protogonyautoxin 3 (CHEBI:169715) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (2,6-diamino-10,10-dihydroxy-5-oxido-9-sulooxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl)methoxycarbonylsulamic acid |