EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | O=C(O)/C(=C\c1ccccc1)CCCCCCO |
| InChI | InChI=1S/C15H20O3/c16-11-7-2-1-6-10-14(15(17)18)12-13-8-4-3-5-9-13/h3-5,8-9,12,16H,1-2,6-7,10-11H2,(H,17,18)/b14-12- |
| InChIKey | OLLBFGFZWVXNIL-OWBHPGMISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2Z)-8-hydroxy-2-(phenylmethylidene)octanoic acid (CHEBI:169702) is a cinnamic acids (CHEBI:23252) |
| IUPAC Name |
|---|
| (2Z)-2-benzylidene-8-hydroxyoctanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 74853601 | ChemSpider |
| HMDB0134149 | HMDB |