EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N4O3 |
| Net Charge | 0 |
| Average Mass | 296.286 |
| Monoisotopic Mass | 296.09094 |
| SMILES | O=C1Nc2c(C(=O)O)ccnc2N(C2CC2)c2ncccc21 |
| InChI | InChI=1S/C15H12N4O3/c20-14-10-2-1-6-16-12(10)19(8-3-4-8)13-11(18-14)9(15(21)22)5-7-17-13/h1-2,5-8H,3-4H2,(H,18,20)(H,21,22) |
| InChIKey | WDXCMIDQWGYHIN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Carboxynevirapine (CHEBI:169675) is a aromatic amine (CHEBI:33860) |
| 4-Carboxynevirapine (CHEBI:169675) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-cyclopropyl-10-oxo-2,4,9,15-tetrazatricyclo[9.4.0.03,8]pentadeca-1(11),3,5,7,12,14-hexaene-7-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0060759 | HMDB |
| 8884376 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:245501-02-4 | ChemIDplus |