EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H25NO9S2 |
| Net Charge | 0 |
| Average Mass | 451.519 |
| Monoisotopic Mass | 451.09707 |
| SMILES | O=S(=O)(O)O/N=C(\CCCCc1ccccc1)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C17H25NO9S2/c19-10-12-14(20)15(21)16(22)17(26-12)28-13(18-27-29(23,24)25)9-5-4-8-11-6-2-1-3-7-11/h1-3,6-7,12,14-17,19-22H,4-5,8-10H2,(H,23,24,25)/b18-13+ |
| InChIKey | PJZFULXMEGMUDK-QGOAFFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Phenylbutyl glucosinolate (CHEBI:169658) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-5-phenyl-N-sulooxypentanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038415 | HMDB |
| 35014573 | ChemSpider |