EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15BrO2 |
| Net Charge | 0 |
| Average Mass | 235.121 |
| Monoisotopic Mass | 234.02554 |
| SMILES | CCCCCC/C(Br)=C\C(=O)O |
| InChI | InChI=1S/C9H15BrO2/c1-2-3-4-5-6-8(10)7-9(11)12/h7H,2-6H2,1H3,(H,11,12)/b8-7+ |
| InChIKey | FSGDUVOQJQYMNR-BQYQJAHWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-bromo-2E-nonenoic acid (CHEBI:169656) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-3-bromonon-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01090080 | LIPID MAPS |