EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO10 |
| Net Charge | 0 |
| Average Mass | 393.389 |
| Monoisotopic Mass | 393.16350 |
| SMILES | CCC(C)(C#N)OC1OC(COC2OC(CO)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C16H27NO10/c1-3-16(2,6-17)27-15-13(23)11(21)10(20)8(26-15)5-24-14-12(22)9(19)7(4-18)25-14/h7-15,18-23H,3-5H2,1-2H3 |
| InChIKey | NUKMOAMTVXXKKG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6'-Apiosyllotaustralin (CHEBI:169655) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| 2-[6-[[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxy-2-methylbutanenitrile |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034207 | HMDB |