EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N4O5 |
| Net Charge | 0 |
| Average Mass | 260.250 |
| Monoisotopic Mass | 260.11207 |
| SMILES | NC(=O)CCC(NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H16N4O5/c10-4(3-7(12)15)8(16)13-5(9(17)18)1-2-6(11)14/h4-5H,1-3,10H2,(H2,11,14)(H2,12,15)(H,13,16)(H,17,18) |
| InChIKey | QCWJKJLNCFEVPQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asparaginyl-Glutamine (CHEBI:169649) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| 5-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028729 | HMDB |
| 16568260 | ChemSpider |