EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O4 |
| Net Charge | 0 |
| Average Mass | 202.250 |
| Monoisotopic Mass | 202.12051 |
| SMILES | CCCCOC(=O)C(=O)OCCCC |
| InChI | InChI=1S/C10H18O4/c1-3-5-7-13-9(11)10(12)14-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | JKRZOJADNVOXPM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalic acid dibutyl ester (CHEBI:169625) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| dibutyl oxalate |
| Manual Xrefs | Databases |
|---|---|
| 15472 | ChemSpider |
| HMDB0040196 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2050-60-4 | ChemIDplus |