EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H39N5O6 |
| Net Charge | 0 |
| Average Mass | 445.561 |
| Monoisotopic Mass | 445.29003 |
| SMILES | CC(C)[C@H](NC(=O)[C@H](N)CCCCN)C(=O)N[C@@H](C(=O)N[C@H](C(=O)O)[C@H](C)O)C(C)C |
| InChI | InChI=1S/C20H39N5O6/c1-10(2)14(23-17(27)13(22)8-6-7-9-21)18(28)24-15(11(3)4)19(29)25-16(12(5)26)20(30)31/h10-16,26H,6-9,21-22H2,1-5H3,(H,23,27)(H,24,28)(H,25,29)(H,30,31)/t12-,13+,14-,15+,16-/m0/s1 |
| InChIKey | VSLCIGXQLCYQTD-NPJQDHAYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dynorphin B (10-13) (CHEBI:169592) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| (2S,3S)-2-[[(2R)-2-[[(2S)-2-[[(2R)-2,6-diaminohexanoyl]amino]-3-methylbutanoyl]amino]-3-methylbutanoyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 30776665 | ChemSpider |
| HMDB0012936 | HMDB |