EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24N2O11S2 |
| Net Charge | 0 |
| Average Mass | 508.527 |
| Monoisotopic Mass | 508.08215 |
| SMILES | COc1cccc2c1c(C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O)cn2OC |
| InChI | InChI=1S/C18H24N2O11S2/c1-28-11-5-3-4-10-14(11)9(7-20(10)29-2)6-13(19-31-33(25,26)27)32-18-17(24)16(23)15(22)12(8-21)30-18/h3-5,7,12,15-18,21-24H,6,8H2,1-2H3,(H,25,26,27)/b19-13+ |
| InChIKey | OTCXWQPXFQXGTP-CPNJWEJPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4-Dimethoxyglucobrassicin (CHEBI:169561) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-2-(1,4-dimethoxyindol-3-yl)-N-sulooxyethanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014339 | ChemSpider |
| HMDB0036986 | HMDB |