EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H38O10 |
| Net Charge | 0 |
| Average Mass | 666.723 |
| Monoisotopic Mass | 666.24650 |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)C2C(c3c(O)cc(/C=C/c4ccc(O)cc4O)cc3O)C=C(CO)CC2c2ccc(O)cc2O)c1O |
| InChI | InChI=1S/C39H38O10/c1-20(2)3-9-27-31(43)12-11-28(38(27)48)39(49)36-29(26-10-8-25(42)18-33(26)45)13-22(19-40)14-30(36)37-34(46)15-21(16-35(37)47)4-5-23-6-7-24(41)17-32(23)44/h3-8,10-12,14-18,29-30,36,40-48H,9,13,19H2,1-2H3/b5-4+ |
| InChIKey | WVWPUTNGENEOCM-SNAWJCMRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-{6-[2,4-dihydroxy-3-(3-methylbut-2-en-1-yl)benzoyl]-5-(2,4-dihydroxyphenyl)-3-(hydroxymethyl)cyclohex-2-en-1-yl}-5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]benzene-1,3-diol (CHEBI:169557) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| [2,4-dihydroxy-3-(3-methylbut-2-enyl)phenyl]-[6-(2,4-dihydroxyphenyl)-2-[4-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2,6-dihydroxyphenyl]-4-(hydroxymethyl)cyclohex-3-en-1-yl]methanone |
| Manual Xrefs | Databases |
|---|---|
| 74886565 | ChemSpider |
| HMDB0126250 | HMDB |