EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:169553 - Dimethylprotoporphyrin IX dimethyl ester
| Formula | C36H38N4O4 |
| Net Charge | 0 |
| Average Mass | 590.724 |
| Monoisotopic Mass | 590.28931 |
| SMILES | C=Cc1c(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5C=C)C(C)=C4CCC(=O)OC)C(CCC(=O)OC)=C3C |
| InChI | InChI=1S/C36H38N4O4/c1-9-23-19(3)27-15-28-21(5)25(11-13-35(41)43-7)33(39-28)18-34-26(12-14-36(42)44-8)22(6)30(40-34)17-32-24(10-2)20(4)29(38-32)16-31(23)37-27/h9-10,15-18,37-38H,1-2,11-14H2,3-8H3/b27-15-,28-15-,29-16-,30-17-,31-16-,32-17-,33-18-,34-18- |
| InChIKey | LQBPATQBTSBIIH-MFBGAUBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dimethylprotoporphyrin IX dimethyl ester (CHEBI:169553) is a porphyrins (CHEBI:26214) |
| IUPAC Name |
|---|
| methyl 3-[8,13-bis(ethenyl)-18-(3-methoxy-3-oxopropyl)-3,7,12,17-tetramethyl-22,23-dihydroporphyrin-2-yl]propanoate |