EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClNO3 |
| Net Charge | 0 |
| Average Mass | 277.707 |
| Monoisotopic Mass | 277.05057 |
| SMILES | Cc1c(Nc2ccccc2C(=O)O)ccc(O)c1Cl |
| InChI | InChI=1S/C14H12ClNO3/c1-8-10(6-7-12(17)13(8)15)16-11-5-3-2-4-9(11)14(18)19/h2-7,16-17H,1H3,(H,18,19) |
| InChIKey | VRNDVGVAHVCCCU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2-methyl-3-chloro-4-hydroxyphenyl)anthranilic acid (CHEBI:169539) is a aminobenzoic acid (CHEBI:22495) |
| IUPAC Name |
|---|
| 2-(3-chloro-4-hydroxy-2-methylanilino)benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 48488 | ChemSpider |
| HMDB0060009 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:77605-73-3 | ChemIDplus |