EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N4O2 |
| Net Charge | 0 |
| Average Mass | 240.307 |
| Monoisotopic Mass | 240.15863 |
| SMILES | NC(CCCCNCCc1cncn1)C(=O)O |
| InChI | InChI=1S/C11H20N4O2/c12-10(11(16)17)3-1-2-5-13-6-4-9-7-14-8-15-9/h7-8,10,13H,1-6,12H2,(H,14,15)(H,16,17) |
| InChIKey | LFNFNJYYTXESHV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Gizzerosine (CHEBI:169532) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 2-amino-6-[2-(1H-imidazol-5-yl)ethylamino]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8552449 | ChemSpider |
| HMDB0039160 | HMDB |