EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO6 |
| Net Charge | 0 |
| Average Mass | 411.454 |
| Monoisotopic Mass | 411.16819 |
| SMILES | COc1cc2c(C=O)c3c4c(c(OC)c(OC)c(OC)c4c2cc1OC)CCN3C |
| InChI | InChI=1S/C23H25NO6/c1-24-8-7-12-18-19(22(29-5)23(30-6)21(12)28-4)14-10-17(27-3)16(26-2)9-13(14)15(11-25)20(18)24/h9-11H,7-8H2,1-6H3 |
| InChIKey | JSQVAGZIQIKFIG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Formyldehydrothalicsimidine (CHEBI:169526) is a isoquinoline alkaloid (CHEBI:24921) |
| IUPAC Name |
|---|
| 4,5,14,15,16-pentamethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,8,13(17),14-heptaene-8-carbaldehyde |
| Manual Xrefs | Databases |
|---|---|
| 30776974 | ChemSpider |
| HMDB0033097 | HMDB |