EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N4O2S2 |
| Net Charge | 0 |
| Average Mass | 354.501 |
| Monoisotopic Mass | 354.11842 |
| SMILES | C=CCSS/C(CCO)=C(/C)N(C=O)Cc1cnc(C)nc1N |
| InChI | InChI=1S/C15H22N4O2S2/c1-4-7-22-23-14(5-6-20)11(2)19(10-21)9-13-8-17-12(3)18-15(13)16/h4,8,10,20H,1,5-7,9H2,2-3H3,(H2,16,17,18)/b14-11- |
| InChIKey | WNCAVNGLACHSRZ-KAMYIIQDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Allithiamine (CHEBI:169524) is a aminopyrimidine (CHEBI:38338) |
| IUPAC Name |
|---|
| N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(Z)-5-hydroxy-3-(prop-2-enyldisulanyl)pent-2-en-2-yl]ormamide |