EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O17S |
| Net Charge | 0 |
| Average Mass | 562.414 |
| Monoisotopic Mass | 562.02647 |
| SMILES | O=C1OCC2OC(O)C(O)C(OC(=O)c3cc(O)c(O)c(O)c3-c3c1cc(O)c(O)c3O)C2OS(=O)(=O)O |
| InChI | InChI=1S/C20H18O17S/c21-6-1-4-9(13(25)11(6)23)10-5(2-7(22)12(24)14(10)26)19(29)36-17-15(27)20(30)35-8(3-34-18(4)28)16(17)37-38(31,32)33/h1-2,8,15-17,20-27,30H,3H2,(H,31,32,33) |
| InChIKey | HAPCKMRMLCABEH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| {6,7,8,11,12,13,21,22-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.0?,?.0??,??]tricosa-4,6,8,10,12,14-hexaen-23-yl}oxidanesulfonic acid (CHEBI:169516) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (6,7,8,11,12,13,21,22-octahydroxy-3,16-dioxo-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl) hydrogen sulate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133407 | HMDB |