EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H48O3 |
| Net Charge | 0 |
| Average Mass | 468.722 |
| Monoisotopic Mass | 468.36035 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(O)(C3CC3)C3CC3)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C31H48O3/c1-20(6-4-17-31(34,24-10-11-24)25-12-13-25)27-14-15-28-22(7-5-16-30(27,28)3)8-9-23-18-26(32)19-29(33)21(23)2/h8-9,20,24-29,32-34H,2,4-7,10-19H2,1,3H3/b22-8+,23-9-/t20-,26-,27-,28+,29+,30-/m1/s1 |
| InChIKey | XLOOAPQXGQUZDQ-FLOOHNOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha,25-dihydroxy-(26,26)-(27,27)-diethanovitamin D3 / 1alpha,25-dihydroxy-(26,26)-(27,27)-diethanocholecalciferol (CHEBI:169498) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6,6-dicyclopropyl-6-hydroxyhexan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826524 | ChemSpider |
| LMST03020481 | LIPID MAPS |