EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O17S |
| Net Charge | 0 |
| Average Mass | 564.430 |
| Monoisotopic Mass | 564.04212 |
| SMILES | O=C(OC1C(CO)OC(O)C(O)C1OC(=O)c1cc(O)c(OS(=O)(=O)O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C20H20O17S/c21-5-12-16(35-18(28)6-1-8(22)13(26)9(23)2-6)17(14(27)20(30)34-12)36-19(29)7-3-10(24)15(11(25)4-7)37-38(31,32)33/h1-4,12,14,16-17,20-27,30H,5H2,(H,31,32,33) |
| InChIKey | LAWGOEOXWMUJAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Malus domestica (ncbitaxon:3750) | exocarp (BTO:0000733) | MetaboLights (MTBLS2384) | Strain: Malus x domestica Borkh. cv. Ruixue |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [4-({[2,3-dihydroxy-6-(hydroxymethyl)-5-(3,4,5-trihydroxybenzoyloxy)oxan-4-yl]oxy}carbonyl)-2,6-dihydroxyphenyl]oxidanesulfonic acid (CHEBI:169494) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [4-(3,5-dihydroxy-4-sulooxybenzoyl)oxy-5,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 3,4,5-trihydroxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133144 | HMDB |